C13H16N2O — CID 168684957
1-(4,6-dimethyl-2-pyridinyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168684957) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2-pyridinyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(4,6-dimethyl-2-pyridinyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168684957 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-(4,6-dimethyl-2-pyridinyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2cc(C)cc(C)n2)C1 |
| InChI | InChI=1S/C13H16N2O/c1-4-11-7-13(16)15(8-11)12-6-9(2)5-10(3)14-12/h4-6,11H,1,7-8H2,2-3H3 |
| InChIKey | KQTFAXAMSOMDEJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|