C9H11N3OS — CID 168685096
4-ethenyl-1-(3-methyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one (PubChem CID 168685096) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-ethenyl-1-(3-methyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-(3-methyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168685096 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 4-ethenyl-1-(3-methyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2nc(C)ns2)C1 |
| InChI | InChI=1S/C9H11N3OS/c1-3-7-4-8(13)12(5-7)9-10-6(2)11-14-9/h3,7H,1,4-5H2,2H3 |
| InChIKey | XLMAJZDHBJAPAT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|