C11H11BrFNO4S — CID 168714044
1-(4-bromo-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714044) has the molecular formula C11H11BrFNO4S and a molecular weight of 352.18 g/mol. Its IUPAC name is 1-(4-bromo-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(4-bromo-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714044 |
| Molecular Formula | C11H11BrFNO4S |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 1-(4-bromo-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | COc1cc(Br)ccc1N1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H11BrFNO4S/c1-18-10-4-7(12)2-3-9(10)14-6-8(5-11(14)15)19(13,16)17/h2-4,8H,5-6H2,1H3 |
| InChIKey | YXKFBAGHSDJYPW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |