C11H10ClN3O3S — CID 168718905
1-(2-chloro-4-cyanophenyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168718905) has the molecular formula C11H10ClN3O3S and a molecular weight of 299.74 g/mol. Its IUPAC name is 1-(2-chloro-4-cyanophenyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(2-chloro-4-cyanophenyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718905 |
| Molecular Formula | C11H10ClN3O3S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 1-(2-chloro-4-cyanophenyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | N#Cc1ccc(N2CC(S(N)(=O)=O)CC2=O)c(Cl)c1 |
| InChI | InChI=1S/C11H10ClN3O3S/c12-9-3-7(5-13)1-2-10(9)15-6-8(4-11(15)16)19(14,17)18/h1-3,8H,4,6H2,(H2,14,17,18) |
| InChIKey | KEBIDIFTBPVFKF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |