C18H15Cl2NO4 — CID 9056972
(2-methoxyphenyl) (3S)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9056972) has the molecular formula C18H15Cl2NO4 and a molecular weight of 380.23 g/mol. Its IUPAC name is (2-methoxyphenyl) (3S)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-methoxyphenyl) (3S)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9056972 |
| Molecular Formula | C18H15Cl2NO4 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | (2-methoxyphenyl) (3S)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccccc1OC(=O)[C@H]1CC(=O)N(c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C18H15Cl2NO4/c1-24-15-4-2-3-5-16(15)25-18(23)11-8-17(22)21(10-11)14-9-12(19)6-7-13(14)20/h2-7,9,11H,8,10H2,1H3/t11-/m0/s1 |
| InChIKey | XASGSWXVJXGLGN-NSHDSACASA-N |
| XLogP | 3.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|