C21H21Cl2NO3 — CID 9056952
(5-methyl-2-propan-2-ylphenyl) (3S)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9056952) has the molecular formula C21H21Cl2NO3 and a molecular weight of 406.31 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) (3S)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (5-methyl-2-propan-2-ylphenyl) (3S)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9056952 |
| Molecular Formula | C21H21Cl2NO3 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) (3S)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(C(C)C)c(OC(=O)[C@H]2CC(=O)N(c3cc(Cl)ccc3Cl)C2)c1 |
| InChI | InChI=1S/C21H21Cl2NO3/c1-12(2)16-6-4-13(3)8-19(16)27-21(26)14-9-20(25)24(11-14)18-10-15(22)5-7-17(18)23/h4-8,10,12,14H,9,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | QFMRVHLNLGFBKR-AWEZNQCLSA-N |
| XLogP | 5.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|