C22H20N2O4 — CID 9057356
quinolin-8-yl (3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9057356) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is quinolin-8-yl (3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | quinolin-8-yl (3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9057356 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | quinolin-8-yl (3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1ccc(N2C[C@@H](C(=O)Oc3cccc4cccnc34)CC2=O)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-2-27-18-10-8-17(9-11-18)24-14-16(13-20(24)25)22(26)28-19-7-3-5-15-6-4-12-23-21(15)19/h3-12,16H,2,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | JRSXICMMJABUOT-INIZCTEOSA-N |
| XLogP | 3.59 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|