C22H20N2O3 — CID 9057277
quinolin-8-yl (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9057277) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is quinolin-8-yl (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | quinolin-8-yl (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9057277 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | quinolin-8-yl (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCc1ccc(N2C[C@H](C(=O)Oc3cccc4cccnc34)CC2=O)cc1 |
| InChI | InChI=1S/C22H20N2O3/c1-2-15-8-10-18(11-9-15)24-14-17(13-20(24)25)22(26)27-19-7-3-5-16-6-4-12-23-21(16)19/h3-12,17H,2,13-14H2,1H3/t17-/m1/s1 |
| InChIKey | RKQBITHMQOMWCJ-QGZVFWFLSA-N |
| XLogP | 3.76 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|