C20H20ClN3O4 — CID 7871437
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7871437) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7871437 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCc1ccc(N2C[C@H](C(=O)OCC(=O)Nc3cccnc3Cl)CC2=O)cc1 |
| InChI | InChI=1S/C20H20ClN3O4/c1-2-13-5-7-15(8-6-13)24-11-14(10-18(24)26)20(27)28-12-17(25)23-16-4-3-9-22-19(16)21/h3-9,14H,2,10-12H2,1H3,(H,23,25)/t14-/m1/s1 |
| InChIKey | GOQFJSPAPCJTEY-CQSZACIVSA-N |
| XLogP | 2.83 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|