C19H18ClN3O4S — CID 55546544
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 55546544) has the molecular formula C19H18ClN3O4S and a molecular weight of 419.89 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 55546544 |
| Molecular Formula | C19H18ClN3O4S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CSc1ccc(N2CC(C(=O)OCC(=O)Nc3cccnc3Cl)CC2=O)cc1 |
| InChI | InChI=1S/C19H18ClN3O4S/c1-28-14-6-4-13(5-7-14)23-10-12(9-17(23)25)19(26)27-11-16(24)22-15-3-2-8-21-18(15)20/h2-8,12H,9-11H2,1H3,(H,22,24) |
| InChIKey | PSNBLMMWHPBYAM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|