C19H18FNO4 — CID 43044149
(4-methoxyphenyl) 1-(3-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 43044149) has the molecular formula C19H18FNO4 and a molecular weight of 343.35 g/mol. Its IUPAC name is (4-methoxyphenyl) 1-(3-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-methoxyphenyl) 1-(3-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 43044149 |
| Molecular Formula | C19H18FNO4 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (4-methoxyphenyl) 1-(3-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccc(OC(=O)C2CC(=O)N(c3ccc(C)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C19H18FNO4/c1-12-3-4-14(10-17(12)20)21-11-13(9-18(21)22)19(23)25-16-7-5-15(24-2)6-8-16/h3-8,10,13H,9,11H2,1-2H3 |
| InChIKey | MTWJREDWAYCHDB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|