C20H19NO6 — CID 9057135
(4-methoxycarbonylphenyl) (3R)-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9057135) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) (3R)-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) (3R)-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9057135 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (4-methoxycarbonylphenyl) (3R)-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)[C@@H]2CC(=O)N(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C20H19NO6/c1-25-16-9-5-15(6-10-16)21-12-14(11-18(21)22)20(24)27-17-7-3-13(4-8-17)19(23)26-2/h3-10,14H,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | KTJIXZKFBULCKK-CQSZACIVSA-N |
| XLogP | 2.44 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|