C19H23ClN2O5 — CID 129353558
3-[[(3R)-1-(2-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]-(oxan-4-yl)amino]propanoic acid (PubChem CID 129353558) has the molecular formula C19H23ClN2O5 and a molecular weight of 394.86 g/mol. Its IUPAC name is 3-[[(3R)-1-(2-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[[(3R)-1-(2-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 129353558 |
| Molecular Formula | C19H23ClN2O5 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 3-[[(3R)-1-(2-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]-(oxan-4-yl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)[C@@H]1CC(=O)N(c2ccccc2Cl)C1)C1CCOCC1 |
| InChI | InChI=1S/C19H23ClN2O5/c20-15-3-1-2-4-16(15)22-12-13(11-17(22)23)19(26)21(8-5-18(24)25)14-6-9-27-10-7-14/h1-4,13-14H,5-12H2,(H,24,25)/t13-/m1/s1 |
| InChIKey | UZVNPGSWYVLATF-CYBMUJFWSA-N |
| XLogP | 2.18 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |