C21H33ClN2O4 — CID 119820820
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylacetamide;hydrochloride (PubChem CID 119820820) has the molecular formula C21H33ClN2O4 and a molecular weight of 412.96 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylacetamide;hydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119820820 |
| Molecular Formula | C21H33ClN2O4 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylacetamide;hydrochloride |
| SMILES | COc1cc(OC)cc(OCCCN(C)C(=O)CC2CC3CCC(C2)N3)c1.Cl |
| InChI | InChI=1S/C21H32N2O4.ClH/c1-23(21(24)11-15-9-16-5-6-17(10-15)22-16)7-4-8-27-20-13-18(25-2)12-19(14-20)26-3;/h12-17,22H,4-11H2,1-3H3;1H |
| InChIKey | GOLIDFFKHXLKPK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|