C18H29ClN2O5S — CID 119753760
4-methoxy-N-methyl-N-[3-(3-methylsulfonylphenoxy)propyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119753760) has the molecular formula C18H29ClN2O5S and a molecular weight of 420.96 g/mol. Its IUPAC name is 4-methoxy-N-methyl-N-[3-(3-methylsulfonylphenoxy)propyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-methoxy-N-methyl-N-[3-(3-methylsulfonylphenoxy)propyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119753760 |
| Molecular Formula | C18H29ClN2O5S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-methoxy-N-methyl-N-[3-(3-methylsulfonylphenoxy)propyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)N(C)CCCOc2cccc(S(C)(=O)=O)c2)CCNCC1.Cl |
| InChI | InChI=1S/C18H28N2O5S.ClH/c1-20(17(21)18(24-2)8-10-19-11-9-18)12-5-13-25-15-6-4-7-16(14-15)26(3,22)23;/h4,6-7,14,19H,5,8-13H2,1-3H3;1H |
| InChIKey | ZAZUYHSVVLXHGH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|