C18H27NO5S — CID 153279834
(2S)-2-[3-(3-methylsulfonylphenoxy)propyl]-1-oxa-8-azaspiro[4.5]decan-2-ol (PubChem CID 153279834) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is (2S)-2-[3-(3-methylsulfonylphenoxy)propyl]-1-oxa-8-azaspiro[4.5]decan-2-ol.
| Compound Name | (2S)-2-[3-(3-methylsulfonylphenoxy)propyl]-1-oxa-8-azaspiro[4.5]decan-2-ol |
|---|---|
| PubChem CID | 153279834 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (2S)-2-[3-(3-methylsulfonylphenoxy)propyl]-1-oxa-8-azaspiro[4.5]decan-2-ol |
| SMILES | CS(=O)(=O)c1cccc(OCCC[C@@]2(O)CCC3(CCNCC3)O2)c1 |
| InChI | InChI=1S/C18H27NO5S/c1-25(21,22)16-5-2-4-15(14-16)23-13-3-6-18(20)8-7-17(24-18)9-11-19-12-10-17/h2,4-5,14,19-20H,3,6-13H2,1H3/t18-/m0/s1 |
| InChIKey | RYRJOBJPYIETBH-SFHVURJKSA-N |
| XLogP | 1.87 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|