About 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine
5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine (PubChem CID 137344399) has the molecular formula C13H17ClN4O2
and a molecular weight of 296.76 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine |
| PubChem CID | 137344399 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine |
| SMILES | CN(CCCOc1cccc(Cl)c1)c1nnc(CN)o1 |
| InChI | InChI=1S/C13H17ClN4O2/c1-18(13-17-16-12(9-15)20-13)6-3-7-19-11-5-2-4-10(14)8-11/h2,4-5,8H,3,6-7,9,15H2,1H3 |
| InChIKey | QSIWSNQJUUDSFF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine (CID 137344399) is 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine is CN(CCCOc1cccc(Cl)c1)c1nnc(CN)o1.
What is the InChIKey of 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine?
The InChIKey is QSIWSNQJUUDSFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN4O2/c1-18(13-17-16-12(9-15)20-13)6-3-7-19-11-5-2-4-10(14)8-11/h2,4-5,8H,3,6-7,9,15H2,1H3.
What are the key properties of 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine?
5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine has a molecular weight of 296.76 g/mol, XLogP of 2.09, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 137344399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).