C15H20ClN3O2 — CID 52679753
3-(3-chlorophenoxy)-N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-N-methylpropan-1-amine (PubChem CID 52679753) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-N-methylpropan-1-amine.
| Compound Name | 3-(3-chlorophenoxy)-N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 52679753 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-(3-chlorophenoxy)-N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-N-methylpropan-1-amine |
| SMILES | CCc1noc(CN(C)CCCOc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-3-14-17-15(21-18-14)11-19(2)8-5-9-20-13-7-4-6-12(16)10-13/h4,6-7,10H,3,5,8-9,11H2,1-2H3 |
| InChIKey | WNWVITDDYUVYIK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|