C18H20ClFN2O2 — CID 55870003
2-[3-(3-chlorophenoxy)propyl-methylamino]-2-(4-fluorophenyl)acetamide (PubChem CID 55870003) has the molecular formula C18H20ClFN2O2 and a molecular weight of 350.82 g/mol. Its IUPAC name is 2-[3-(3-chlorophenoxy)propyl-methylamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | 2-[3-(3-chlorophenoxy)propyl-methylamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 55870003 |
| Molecular Formula | C18H20ClFN2O2 |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[3-(3-chlorophenoxy)propyl-methylamino]-2-(4-fluorophenyl)acetamide |
| SMILES | CN(CCCOc1cccc(Cl)c1)C(C(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20ClFN2O2/c1-22(10-3-11-24-16-5-2-4-14(19)12-16)17(18(21)23)13-6-8-15(20)9-7-13/h2,4-9,12,17H,3,10-11H2,1H3,(H2,21,23) |
| InChIKey | PWSCEHPEKGXAOX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|