C13H19FN2O2 — CID 46444990
2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide (PubChem CID 46444990) has the molecular formula C13H19FN2O2 and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide.
| Compound Name | 2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide |
|---|---|
| PubChem CID | 46444990 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide |
| SMILES | CC(C(N)=O)N(C)CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C13H19FN2O2/c1-10(13(15)17)16(2)8-3-9-18-12-6-4-11(14)5-7-12/h4-7,10H,3,8-9H2,1-2H3,(H2,15,17) |
| InChIKey | HDLMZFKZXFDYLN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|