C14H20FN3O3 — CID 17399068
2-[2-(4-fluorophenoxy)ethyl-methylamino]-N-(methylcarbamoyl)propanamide (PubChem CID 17399068) has the molecular formula C14H20FN3O3 and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-[2-(4-fluorophenoxy)ethyl-methylamino]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[2-(4-fluorophenoxy)ethyl-methylamino]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 17399068 |
| Molecular Formula | C14H20FN3O3 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-[2-(4-fluorophenoxy)ethyl-methylamino]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)N(C)CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FN3O3/c1-10(13(19)17-14(20)16-2)18(3)8-9-21-12-6-4-11(15)5-7-12/h4-7,10H,8-9H2,1-3H3,(H2,16,17,19,20) |
| InChIKey | KONOEXVRVBUJSV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |