C18H29N3O3 — CID 51245206
N-(tert-butylcarbamoyl)-2-[methyl-[2-(2-methylphenoxy)ethyl]amino]propanamide (PubChem CID 51245206) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-[methyl-[2-(2-methylphenoxy)ethyl]amino]propanamide.
| Compound Name | N-(tert-butylcarbamoyl)-2-[methyl-[2-(2-methylphenoxy)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 51245206 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-[methyl-[2-(2-methylphenoxy)ethyl]amino]propanamide |
| SMILES | Cc1ccccc1OCCN(C)C(C)C(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H29N3O3/c1-13-9-7-8-10-15(13)24-12-11-21(6)14(2)16(22)19-17(23)20-18(3,4)5/h7-10,14H,11-12H2,1-6H3,(H2,19,20,22,23) |
| InChIKey | POQZGQSDEOFPPR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |