C19H31N3O5S — CID 95344181
(2R)-N-(tert-butylcarbamoyl)-2-[methyl-[3-(3-methylsulfonylphenoxy)propyl]amino]propanamide (PubChem CID 95344181) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is (2R)-N-(tert-butylcarbamoyl)-2-[methyl-[3-(3-methylsulfonylphenoxy)propyl]amino]propanamide.
| Compound Name | (2R)-N-(tert-butylcarbamoyl)-2-[methyl-[3-(3-methylsulfonylphenoxy)propyl]amino]propanamide |
|---|---|
| PubChem CID | 95344181 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2R)-N-(tert-butylcarbamoyl)-2-[methyl-[3-(3-methylsulfonylphenoxy)propyl]amino]propanamide |
| SMILES | C[C@H](C(=O)NC(=O)NC(C)(C)C)N(C)CCCOc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H31N3O5S/c1-14(17(23)20-18(24)21-19(2,3)4)22(5)11-8-12-27-15-9-7-10-16(13-15)28(6,25)26/h7,9-10,13-14H,8,11-12H2,1-6H3,(H2,20,21,23,24)/t14-/m1/s1 |
| InChIKey | WBMVBNBDBSXJLV-CQSZACIVSA-N |
| XLogP | 1.80 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|