C16H24FN3O3 — CID 42960410
N-(ethylcarbamoyl)-2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide (PubChem CID 42960410) has the molecular formula C16H24FN3O3 and a molecular weight of 325.38 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide.
| Compound Name | N-(ethylcarbamoyl)-2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide |
|---|---|
| PubChem CID | 42960410 |
| Molecular Formula | C16H24FN3O3 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)N(C)CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C16H24FN3O3/c1-4-18-16(22)19-15(21)12(2)20(3)10-5-11-23-14-8-6-13(17)7-9-14/h6-9,12H,4-5,10-11H2,1-3H3,(H2,18,19,21,22) |
| InChIKey | AWLJMTMUJLXVKM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|