C21H27FN2O4 — CID 46444904
N-(3,4-dimethoxyphenyl)-2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide (PubChem CID 46444904) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide |
|---|---|
| PubChem CID | 46444904 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[3-(4-fluorophenoxy)propyl-methylamino]propanamide |
| SMILES | COc1ccc(NC(=O)C(C)N(C)CCCOc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C21H27FN2O4/c1-15(21(25)23-17-8-11-19(26-3)20(14-17)27-4)24(2)12-5-13-28-18-9-6-16(22)7-10-18/h6-11,14-15H,5,12-13H2,1-4H3,(H,23,25) |
| InChIKey | OISVLBCUWTXIDY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|