C22H28N2O4 — CID 46630573
N-(3,4-dimethoxyphenyl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanamide (PubChem CID 46630573) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 46630573 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanamide |
| SMILES | C=CCOc1ccc(CN(C)C(C)C(=O)Nc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-6-13-28-19-10-7-17(8-11-19)15-24(3)16(2)22(25)23-18-9-12-20(26-4)21(14-18)27-5/h6-12,14,16H,1,13,15H2,2-5H3,(H,23,25) |
| InChIKey | CLXJTEIGUFPHKB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|