C21H26N2O3 — CID 9167652
(2R)-N-(3-methoxyphenyl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanamide (PubChem CID 9167652) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2R)-N-(3-methoxyphenyl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanamide.
| Compound Name | (2R)-N-(3-methoxyphenyl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 9167652 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (2R)-N-(3-methoxyphenyl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanamide |
| SMILES | C=CCOc1ccc(CN(C)[C@H](C)C(=O)Nc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-5-13-26-19-11-9-17(10-12-19)15-23(3)16(2)21(24)22-18-7-6-8-20(14-18)25-4/h5-12,14,16H,1,13,15H2,2-4H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | JDPPULMQZDYJAN-MRXNPFEDSA-N |
| XLogP | 3.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|