C21H25N3O3 — CID 17424194
4-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanoylamino]benzamide (PubChem CID 17424194) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanoylamino]benzamide.
| Compound Name | 4-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 17424194 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 4-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]propanoylamino]benzamide |
| SMILES | C=CCOc1ccc(CN(C)C(C)C(=O)Nc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O3/c1-4-13-27-19-11-5-16(6-12-19)14-24(3)15(2)21(26)23-18-9-7-17(8-10-18)20(22)25/h4-12,15H,1,13-14H2,2-3H3,(H2,22,25)(H,23,26) |
| InChIKey | BUARLRAEJFEREV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|