C23H25N3O3 — CID 9054222
4-[[(2S)-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]propanoyl]amino]benzamide (PubChem CID 9054222) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-[[(2S)-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]propanoyl]amino]benzamide.
| Compound Name | 4-[[(2S)-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 9054222 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 4-[[(2S)-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]propanoyl]amino]benzamide |
| SMILES | COc1ccc2cc(CN(C)[C@@H](C)C(=O)Nc3ccc(C(N)=O)cc3)ccc2c1 |
| InChI | InChI=1S/C23H25N3O3/c1-15(23(28)25-20-9-6-17(7-10-20)22(24)27)26(2)14-16-4-5-19-13-21(29-3)11-8-18(19)12-16/h4-13,15H,14H2,1-3H3,(H2,24,27)(H,25,28)/t15-/m0/s1 |
| InChIKey | VDXMKPVKCCKFGV-HNNXBMFYSA-N |
| XLogP | 3.41 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |