C19H23BrN2O2 — CID 9494784
(2R)-N-(3-bromophenyl)-2-[(4-ethoxyphenyl)methyl-methylamino]propanamide (PubChem CID 9494784) has the molecular formula C19H23BrN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is (2R)-N-(3-bromophenyl)-2-[(4-ethoxyphenyl)methyl-methylamino]propanamide.
| Compound Name | (2R)-N-(3-bromophenyl)-2-[(4-ethoxyphenyl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 9494784 |
| Molecular Formula | C19H23BrN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (2R)-N-(3-bromophenyl)-2-[(4-ethoxyphenyl)methyl-methylamino]propanamide |
| SMILES | CCOc1ccc(CN(C)[C@H](C)C(=O)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C19H23BrN2O2/c1-4-24-18-10-8-15(9-11-18)13-22(3)14(2)19(23)21-17-7-5-6-16(20)12-17/h5-12,14H,4,13H2,1-3H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | UXXVRWFIAKGNBH-CQSZACIVSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |