C20H25ClN2O3 — CID 8024150
(2R)-N-(5-chloro-2-methoxyphenyl)-2-[(4-ethoxyphenyl)methyl-methylamino]propanamide (PubChem CID 8024150) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is (2R)-N-(5-chloro-2-methoxyphenyl)-2-[(4-ethoxyphenyl)methyl-methylamino]propanamide.
| Compound Name | (2R)-N-(5-chloro-2-methoxyphenyl)-2-[(4-ethoxyphenyl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 8024150 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (2R)-N-(5-chloro-2-methoxyphenyl)-2-[(4-ethoxyphenyl)methyl-methylamino]propanamide |
| SMILES | CCOc1ccc(CN(C)[C@H](C)C(=O)Nc2cc(Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C20H25ClN2O3/c1-5-26-17-9-6-15(7-10-17)13-23(3)14(2)20(24)22-18-12-16(21)8-11-19(18)25-4/h6-12,14H,5,13H2,1-4H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | QUAQQISCKYIKKL-CQSZACIVSA-N |
| XLogP | 4.21 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |