C27H31N3O4 — CID 46801521
4-[2-[(4-ethoxyphenyl)methyl-methylamino]propanoylamino]-N-(2-methoxyphenyl)benzamide (PubChem CID 46801521) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 4-[2-[(4-ethoxyphenyl)methyl-methylamino]propanoylamino]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 4-[2-[(4-ethoxyphenyl)methyl-methylamino]propanoylamino]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 46801521 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 4-[2-[(4-ethoxyphenyl)methyl-methylamino]propanoylamino]-N-(2-methoxyphenyl)benzamide |
| SMILES | CCOc1ccc(CN(C)C(C)C(=O)Nc2ccc(C(=O)Nc3ccccc3OC)cc2)cc1 |
| InChI | InChI=1S/C27H31N3O4/c1-5-34-23-16-10-20(11-17-23)18-30(3)19(2)26(31)28-22-14-12-21(13-15-22)27(32)29-24-8-6-7-9-25(24)33-4/h6-17,19H,5,18H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | AWICDXQGDDWGKF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |