C18H25N3O5S — CID 48941722
2-[methyl-[3-(3-methylsulfonylphenoxy)propyl]amino]-N-(3-methyl-1,2-oxazol-5-yl)propanamide (PubChem CID 48941722) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-[methyl-[3-(3-methylsulfonylphenoxy)propyl]amino]-N-(3-methyl-1,2-oxazol-5-yl)propanamide.
| Compound Name | 2-[methyl-[3-(3-methylsulfonylphenoxy)propyl]amino]-N-(3-methyl-1,2-oxazol-5-yl)propanamide |
|---|---|
| PubChem CID | 48941722 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[methyl-[3-(3-methylsulfonylphenoxy)propyl]amino]-N-(3-methyl-1,2-oxazol-5-yl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)N(C)CCCOc2cccc(S(C)(=O)=O)c2)on1 |
| InChI | InChI=1S/C18H25N3O5S/c1-13-11-17(26-20-13)19-18(22)14(2)21(3)9-6-10-25-15-7-5-8-16(12-15)27(4,23)24/h5,7-8,11-12,14H,6,9-10H2,1-4H3,(H,19,22) |
| InChIKey | DDOLTHWBMDUFAB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|