C14H17ClN4O2 — CID 71983485
2-[(6-chloro-3-pyridinyl)methyl-methylamino]-N-(3-methyl-1,2-oxazol-5-yl)propanamide (PubChem CID 71983485) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl-methylamino]-N-(3-methyl-1,2-oxazol-5-yl)propanamide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl-methylamino]-N-(3-methyl-1,2-oxazol-5-yl)propanamide |
|---|---|
| PubChem CID | 71983485 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl-methylamino]-N-(3-methyl-1,2-oxazol-5-yl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)N(C)Cc2ccc(Cl)nc2)on1 |
| InChI | InChI=1S/C14H17ClN4O2/c1-9-6-13(21-18-9)17-14(20)10(2)19(3)8-11-4-5-12(15)16-7-11/h4-7,10H,8H2,1-3H3,(H,17,20) |
| InChIKey | LGSRSVPNFJDEGQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|