C17H19ClN4O2 — CID 124507879
(2R)-2-[(6-chloro-3-pyridinyl)methyl-methylamino]-N-(3-cyano-4,5-dimethylfuran-2-yl)propanamide (PubChem CID 124507879) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is (2R)-2-[(6-chloro-3-pyridinyl)methyl-methylamino]-N-(3-cyano-4,5-dimethylfuran-2-yl)propanamide.
| Compound Name | (2R)-2-[(6-chloro-3-pyridinyl)methyl-methylamino]-N-(3-cyano-4,5-dimethylfuran-2-yl)propanamide |
|---|---|
| PubChem CID | 124507879 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2R)-2-[(6-chloro-3-pyridinyl)methyl-methylamino]-N-(3-cyano-4,5-dimethylfuran-2-yl)propanamide |
| SMILES | Cc1oc(NC(=O)[C@@H](C)N(C)Cc2ccc(Cl)nc2)c(C#N)c1C |
| InChI | InChI=1S/C17H19ClN4O2/c1-10-12(3)24-17(14(10)7-19)21-16(23)11(2)22(4)9-13-5-6-15(18)20-8-13/h5-6,8,11H,9H2,1-4H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | OASZSJRGFIAEHS-LLVKDONJSA-N |
| XLogP | 3.28 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|