C18H18ClN3O — CID 24508359
N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylphthalazin-1-amine (PubChem CID 24508359) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylphthalazin-1-amine.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylphthalazin-1-amine |
|---|---|
| PubChem CID | 24508359 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylphthalazin-1-amine |
| SMILES | Cc1nnc(N(C)CCOc2cccc(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C18H18ClN3O/c1-13-16-8-3-4-9-17(16)18(21-20-13)22(2)10-11-23-15-7-5-6-14(19)12-15/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | RMNPDQKEHLKIML-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |