C20H22ClNO5 — CID 32518368
4-(4-chlorophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-oxobutanamide (PubChem CID 32518368) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 32518368 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-oxobutanamide |
| SMILES | COCCOc1cc(NC(=O)CCC(=O)c2ccc(Cl)cc2)ccc1OC |
| InChI | InChI=1S/C20H22ClNO5/c1-25-11-12-27-19-13-16(7-9-18(19)26-2)22-20(24)10-8-17(23)14-3-5-15(21)6-4-14/h3-7,9,13H,8,10-12H2,1-2H3,(H,22,24) |
| InChIKey | WEHHIIPYPMTRFS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|