C20H24ClNO5 — CID 55624317
2-(4-chloro-2-methylphenoxy)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]propanamide (PubChem CID 55624317) has the molecular formula C20H24ClNO5 and a molecular weight of 393.87 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]propanamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 55624317 |
| Molecular Formula | C20H24ClNO5 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]propanamide |
| SMILES | COCCOc1cc(NC(=O)C(C)Oc2ccc(Cl)cc2C)ccc1OC |
| InChI | InChI=1S/C20H24ClNO5/c1-13-11-15(21)5-7-17(13)27-14(2)20(23)22-16-6-8-18(25-4)19(12-16)26-10-9-24-3/h5-8,11-12,14H,9-10H2,1-4H3,(H,22,23) |
| InChIKey | YIZLXHZZDFQUBK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|