C20H19ClN2O3 — CID 60614683
1-benzyl-3-[3-chloro-4-(furan-2-ylmethoxy)phenyl]-1-methylurea (PubChem CID 60614683) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 1-benzyl-3-[3-chloro-4-(furan-2-ylmethoxy)phenyl]-1-methylurea.
| Compound Name | 1-benzyl-3-[3-chloro-4-(furan-2-ylmethoxy)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 60614683 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-benzyl-3-[3-chloro-4-(furan-2-ylmethoxy)phenyl]-1-methylurea |
| SMILES | CN(Cc1ccccc1)C(=O)Nc1ccc(OCc2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClN2O3/c1-23(13-15-6-3-2-4-7-15)20(24)22-16-9-10-19(18(21)12-16)26-14-17-8-5-11-25-17/h2-12H,13-14H2,1H3,(H,22,24) |
| InChIKey | OWYIYZKSBSTZRB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |