C21H24ClFN4O2 — CID 42747797
1-(3-chloro-4-fluorophenyl)-3-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]urea (PubChem CID 42747797) has the molecular formula C21H24ClFN4O2 and a molecular weight of 418.90 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 42747797 |
| Molecular Formula | C21H24ClFN4O2 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]urea |
| SMILES | CN(C)c1ccc(NC(=O)Nc2ccc(F)c(Cl)c2)cc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H24ClFN4O2/c1-26(2)19-9-7-14(12-16(19)20(28)27-10-4-3-5-11-27)24-21(29)25-15-6-8-18(23)17(22)13-15/h6-9,12-13H,3-5,10-11H2,1-2H3,(H2,24,25,29) |
| InChIKey | VCLXSFMIAQMHJI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|