C23H30N4O2 — CID 4310534
1-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-3-(2,3-dimethylphenyl)urea (PubChem CID 4310534) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-3-(2,3-dimethylphenyl)urea.
| Compound Name | 1-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-3-(2,3-dimethylphenyl)urea |
|---|---|
| PubChem CID | 4310534 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-3-(2,3-dimethylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(N(C)C)c(C(=O)N3CCCCC3)c2)c1C |
| InChI | InChI=1S/C23H30N4O2/c1-16-9-8-10-20(17(16)2)25-23(29)24-18-11-12-21(26(3)4)19(15-18)22(28)27-13-6-5-7-14-27/h8-12,15H,5-7,13-14H2,1-4H3,(H2,24,25,29) |
| InChIKey | ASLURPZVWKXMCV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|