C23H39N4O2+ — CID 7306883
diethyl-[2-[[5-(3-methylbutanoylamino)-2-piperidin-1-ylbenzoyl]amino]ethyl]azanium (PubChem CID 7306883) has the molecular formula C23H39N4O2+ and a molecular weight of 403.59 g/mol. Its IUPAC name is diethyl-[2-[[5-(3-methylbutanoylamino)-2-piperidin-1-ylbenzoyl]amino]ethyl]azanium.
| Compound Name | diethyl-[2-[[5-(3-methylbutanoylamino)-2-piperidin-1-ylbenzoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 7306883 |
| Molecular Formula | C23H39N4O2+ |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | diethyl-[2-[[5-(3-methylbutanoylamino)-2-piperidin-1-ylbenzoyl]amino]ethyl]azanium |
| SMILES | CC[NH+](CC)CCNC(=O)c1cc(NC(=O)CC(C)C)ccc1N1CCCCC1 |
| InChI | InChI=1S/C23H38N4O2/c1-5-26(6-2)15-12-24-23(29)20-17-19(25-22(28)16-18(3)4)10-11-21(20)27-13-8-7-9-14-27/h10-11,17-18H,5-9,12-16H2,1-4H3,(H,24,29)(H,25,28)/p+1 |
| InChIKey | CDOIPZMPKAAFGW-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|