C22H38N5O2+ — CID 7230433
diethyl-[2-[[5-(ethylcarbamoylamino)-2-(4-methylpiperidin-1-yl)benzoyl]amino]ethyl]azanium (PubChem CID 7230433) has the molecular formula C22H38N5O2+ and a molecular weight of 404.58 g/mol. Its IUPAC name is diethyl-[2-[[5-(ethylcarbamoylamino)-2-(4-methylpiperidin-1-yl)benzoyl]amino]ethyl]azanium.
| Compound Name | diethyl-[2-[[5-(ethylcarbamoylamino)-2-(4-methylpiperidin-1-yl)benzoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 7230433 |
| Molecular Formula | C22H38N5O2+ |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | diethyl-[2-[[5-(ethylcarbamoylamino)-2-(4-methylpiperidin-1-yl)benzoyl]amino]ethyl]azanium |
| SMILES | CCNC(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NCC[NH+](CC)CC)c1 |
| InChI | InChI=1S/C22H37N5O2/c1-5-23-22(29)25-18-8-9-20(27-13-10-17(4)11-14-27)19(16-18)21(28)24-12-15-26(6-2)7-3/h8-9,16-17H,5-7,10-15H2,1-4H3,(H,24,28)(H2,23,25,29)/p+1 |
| InChIKey | HBQFNZBWESOLKE-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|