C29H24ClN5O4 — CID 42762519
5-[(2-chloro-4-nitrobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 42762519) has the molecular formula C29H24ClN5O4 and a molecular weight of 542.00 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-[(2-chloro-4-nitrobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42762519 |
| Molecular Formula | C29H24ClN5O4 |
| Molecular Weight | 542.00 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 5-[(2-chloro-4-nitrobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCc2cccnc2)c1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C29H24ClN5O4/c30-26-15-23(35(38)39)8-9-24(26)29(37)33-22-7-10-27(34-13-11-20-5-1-2-6-21(20)18-34)25(14-22)28(36)32-17-19-4-3-12-31-16-19/h1-10,12,14-16H,11,13,17-18H2,(H,32,36)(H,33,37) |
| InChIKey | VLVMTDCHZCJVLY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.00 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|