C25H26F2N6O4 — CID 90757091
N-(3,5-difluoro-2-pyridinyl)-4-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide (PubChem CID 90757091) has the molecular formula C25H26F2N6O4 and a molecular weight of 512.52 g/mol. Its IUPAC name is N-(3,5-difluoro-2-pyridinyl)-4-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-(3,5-difluoro-2-pyridinyl)-4-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 90757091 |
| Molecular Formula | C25H26F2N6O4 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | N-(3,5-difluoro-2-pyridinyl)-4-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
| SMILES | COc1cc(NC(=O)Nc2ccc(N3CCN(C(=O)Nc4ncc(F)cc4F)CC3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C25H26F2N6O4/c1-36-20-12-18(13-21(14-20)37-2)30-24(34)29-17-3-5-19(6-4-17)32-7-9-33(10-8-32)25(35)31-23-22(27)11-16(26)15-28-23/h3-6,11-15H,7-10H2,1-2H3,(H,28,31,35)(H2,29,30,34) |
| InChIKey | KSHKQDCOSGPSJY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|