C24H33N5O3 — CID 4043726
N-butyl-4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide (PubChem CID 4043726) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-butyl-4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-butyl-4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 4043726 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-butyl-4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2ccc(NC(=O)Nc3ccccc3OCC)cc2)CC1 |
| InChI | InChI=1S/C24H33N5O3/c1-3-5-14-25-24(31)29-17-15-28(16-18-29)20-12-10-19(11-13-20)26-23(30)27-21-8-6-7-9-22(21)32-4-2/h6-13H,3-5,14-18H2,1-2H3,(H,25,31)(H2,26,27,30) |
| InChIKey | WXBPWYDVOXZJRE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|