C22H26N4O3 — CID 172888667
1-(2-ethoxyphenyl)-3-[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]urea (PubChem CID 172888667) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-(2-ethoxyphenyl)-3-[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 172888667 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]urea |
| SMILES | C=CC(=O)N1CCN(c2ccc(NC(=O)Nc3ccccc3OCC)cc2)CC1 |
| InChI | InChI=1S/C22H26N4O3/c1-3-21(27)26-15-13-25(14-16-26)18-11-9-17(10-12-18)23-22(28)24-19-7-5-6-8-20(19)29-4-2/h3,5-12H,1,4,13-16H2,2H3,(H2,23,24,28) |
| InChIKey | ZHKHOVAYLAHTIA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|