C28H33N5O3 — CID 90750957
N-(2,6-dimethylphenyl)-4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide (PubChem CID 90750957) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 90750957 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc(N2CCN(C(=O)Nc3c(C)cccc3C)CC2)cc1 |
| InChI | InChI=1S/C28H33N5O3/c1-4-36-25-11-6-5-10-24(25)30-27(34)29-22-12-14-23(15-13-22)32-16-18-33(19-17-32)28(35)31-26-20(2)8-7-9-21(26)3/h5-15H,4,16-19H2,1-3H3,(H,31,35)(H2,29,30,34) |
| InChIKey | IVFNUGCBJRAQAS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|