C26H29ClN6O3 — CID 69451484
4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(3-methyl-2-pyridinyl)piperazine-1-carboxamide (PubChem CID 69451484) has the molecular formula C26H29ClN6O3 and a molecular weight of 509.01 g/mol. Its IUPAC name is 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(3-methyl-2-pyridinyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(3-methyl-2-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 69451484 |
| Molecular Formula | C26H29ClN6O3 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(3-methyl-2-pyridinyl)piperazine-1-carboxamide |
| SMILES | CCOc1ccc(Cl)cc1NC(=O)Nc1ccc(N2CCN(C(=O)Nc3ncccc3C)CC2)cc1 |
| InChI | InChI=1S/C26H29ClN6O3/c1-3-36-23-11-6-19(27)17-22(23)30-25(34)29-20-7-9-21(10-8-20)32-13-15-33(16-14-32)26(35)31-24-18(2)5-4-12-28-24/h4-12,17H,3,13-16H2,1-2H3,(H,28,31,35)(H2,29,30,34) |
| InChIKey | MJNHXEIQOZIDFQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|