C17H21ClN2O — CID 22082563
(2R)-N-[2-(4-chlorophenyl)ethyl]-2-cyano-3-cyclopropyl-3-methylbutanamide (PubChem CID 22082563) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is (2R)-N-[2-(4-chlorophenyl)ethyl]-2-cyano-3-cyclopropyl-3-methylbutanamide.
| Compound Name | (2R)-N-[2-(4-chlorophenyl)ethyl]-2-cyano-3-cyclopropyl-3-methylbutanamide |
|---|---|
| PubChem CID | 22082563 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2R)-N-[2-(4-chlorophenyl)ethyl]-2-cyano-3-cyclopropyl-3-methylbutanamide |
| SMILES | CC(C)(C1CC1)[C@H](C#N)C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O/c1-17(2,13-5-6-13)15(11-19)16(21)20-10-9-12-3-7-14(18)8-4-12/h3-4,7-8,13,15H,5-6,9-10H2,1-2H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | YFYKUFPOZRSWSE-OAHLLOKOSA-N |
| XLogP | 3.57 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |